| Identification | |
| Name: | Benzeneacetic acid, a-[[2-(diethylamino)ethyl]amino]-,3-methylbutyl ester, hydrochloride (1:2) |
| Synonyms: | Benzeneaceticacid, a-[[2-(diethylamino)ethyl]amino]-,3-methylbutyl ester, dihydrochloride (9CI); Glycine,N-[2-(diethylamino)ethyl]-2-phenyl-, isopentyl ester, dihydrochloride (8CI);Isopentyl alcohol, ester with N-[2-(diethylamino)ethyl]-2-phenylglycine,dihydrochloride (8CI); Acamylophenine dihydrochloride; Acamylopheninehydrochloride; Camylofin dihydrochloride; Camylofin hydrochloride; Camylofinedihydrochloride; Camylofine hydrochloride; Isopentyl a-[[2-(diethylamino)ethyl]amino]phenylacetatedihydrochloride |
| CAS: | 5892-41-1 |
| EINECS: | 227-571-0 |
| Molecular Formula: | C19H32 N2 O2 . 2 Cl H |
| Molecular Weight: | 393.45 |
| InChI: | InChI=1/C19H32N2O2.2ClH/c1-5-21(6-2)14-13-20-18(17-10-8-7-9-11-17)19(22)23-15-12-16(3)4;;/h7-11,16,18,20H,5-6,12-15H2,1-4H3;2*1H |
| Molecular Structure: | ![(C19H32N2O2.2ClH) Benzeneaceticacid, a-[[2-(diethylamino)ethyl]amino]-,3-methylbutyl ester, dihydrochloride (9CI); Gly...](https://img1.guidechem.com/chem/e/dict/33/5892-41-1.jpg) |
| Properties | |
| Flash Point: | 200.8°C |
| Boiling Point: | 408.4°Cat760mmHg |
| Density: | 0.987g/cm3 |
| Specification: |
Acamylophenine dihydrochloride (CAS NO.5892-41-1) is a moderately-toxic chemical, flammable,thermal decomposition would release toxic fumes of nitrogen oxides and hydrogen chloride,it should be stored in low temperature, ventilation, drying environmental conditions,separated with food and raw materials, besides water, carbon oxides and oxidation of toxic carbon dioxide, dry powder, sand, water mist fire extinguishing agent can be used if emergency. |
| Flash Point: | 200.8°C |
| Safety Data | |
 |
|
