Identification |
Name: | Hexanedioic acid, ester with 2,2-oxybis(ethanol) |
Synonyms: | Hexanedioic acid, ester with 2,2'-oxybis[ethanol] |
CAS: | 58984-19-3 |
EINECS: | 261-541-8 |
Molecular Formula: | C10H18O6 |
Molecular Weight: | 0 |
InChI: | InChI=1/C10H18O6/c11-5-6-15-7-8-16-10(14)4-2-1-3-9(12)13/h11H,1-8H2,(H,12,13) |
Molecular Structure: |
![(C10H18O6) Hexanedioic acid, ester with 2,2'-oxybis[ethanol]](https://img.guidechem.com/cas/gif/58984-19-3.gif) |
Properties |
Flash Point: | 158.5°C |
Boiling Point: | 412.9°C at 760 mmHg |
Density: | 1.197g/cm3 |
Refractive index: | 1.474 |
Flash Point: | 158.5°C |
Safety Data |
|
 |