| Identification | |
| Name: | Benzeneethanamine,4-methoxy-a-methyl-, (aR)- |
| Synonyms: | Benzeneethanamine,4-methoxy-a-methyl-, (R)-;(-)-p-Methoxyamphetamine;(R)-(-)-2-(4-Methoxyphenyl)-1-methylethylamine;(R)-2-(4-Methoxyphenyl)-1-methyl-ethylamine;l-4-Methoxyamphetamine; |
| CAS: | 58993-79-6 |
| Molecular Formula: | C10H15NO |
| Molecular Weight: | 165.23 |
| InChI: | InChI=1/C10H15NO/c1-8(11)7-9-3-5-10(12-2)6-4-9/h3-6,8H,7,11H2,1-2H3/t8-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 107 ºC |
| Boiling Point: | 258 ºC |
| Density: | 0.990 |
| Refractive index: | 1.518 |
| Specification: |
The systematic name of (R)-2-(4-Methoxyphenyl)-1-methylethanamine is (2R)-1-(4-methoxyphenyl)propan-2-amine. With the CAS registry number 58993-79-6, it is also named as Benzeneethanamine,4-methoxy-a-methyl-, (R)-. The product's category is tamsulosin. Moreover, its molecular formula is C10H15NO and its molecular weight is 165.23. The other characteristics of (R)-2-(4-Methoxyphenyl)-1-methylethanamine can be summarized as: (1)ACD/LogP: 1.72; (2)# of Rule of 5 Violations: 0; (3)H bond acceptors: 2; (4)H bond donors: 2; (5)Freely Rotating Bonds: 4; (6)Nominal mass: 165; (7)Average mass: 165.2322; (8)Monoisotopic mass: 165.115364; (9)Polar Surface Area: 12.47 Å2; (10)Index of Refraction: 1.518; (11)Molar Refractivity: 50.6 cm3; (12)Molar Volume: 166.8 cm3; (13)Polarizability: 20.06×10-24cm3; (14)Surface Tension: 35.3 dyne/cm; (15)Density: 0.99 g/cm3; (16)Flash Point: 107.5 °C; (17)Enthalpy of Vaporization: 49.58 kJ/mol; (18)Boiling Point: 258.2 °C at 760 mmHg; (19)Vapour Pressure: 0.0139 mmHg at 25 °C. People can use the following data to convert to the molecule structure. |
| Flash Point: | 107 ºC |
| Safety Data | |
 |
|
