| Identification | |
| Name: | 5-Bromo-2'-deoxyuridine |
| CAS: | 59-14-3 |
| EINECS: | 200-415-9 |
| Molecular Formula: | C9H11BrN2O5 |
| Molecular Weight: | 307.1 |
| InChI: | InChI=1/C9H11BrN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16)/t5-,6+,7+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.905 g/cm3 |
| Stability: | Stable, but may be light sensitive. Incompatible with strong oxidizing agents. |
| Refractive index: | 22 ° (C=1, H2O) |
| Alpha: | 31 º (C=1, 0.1N NAOH) |
| Solubility: | soluble (soluble in caustic soda) |
| Appearance: | white crystalline powder |
| Flash Point: | °C |
| Storage Temperature: | 2-8°C |
| Color: | Crystals from absolute ethanol |
| Usage: | A Thymidine analogue used as a mutagen in genetic research. Selectively incorporated into cellular DNA during S-phase |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
