Identification |
Name: | 1,2-Propanediol,3-(2-methylphenoxy)- |
CAS: | 59-47-2 |
EINECS: | 200-427-4 |
Molecular Formula: | C10H14 O3 |
Molecular Weight: | 182.21 |
InChI: | InChI=1/C10H14O3/c1-8-4-2-3-5-10(8)13-7-9(12)6-11/h2-5,9,11-12H,6-7H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 161.5°C |
Density: | 1.152g/cm3 |
Refractive index: | 1.545 |
Specification: | Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice |
Flash Point: | 161.5°C |
Safety Data |
|
 |