| Identification | |
| Name: | 2,3-Dimercapto-1-propanol |
| Synonyms: | Dimercaprol; 2,3-Dimercaptopropanol; BAL |
| CAS: | 59-52-9 |
| EINECS: | 200-433-7 |
| Molecular Formula: | C3H8OS2 |
| Molecular Weight: | 124.22 |
| InChI: | InChI=1/C3H8OS2/c4-1-3(6)2-5/h3-6H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Density: | 1.239 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, many metals. |
| Refractive index: | 1.57-1.574 |
| Solubility: | 87 g/L (25 ºC) in water |
| Appearance: | clear almost colorless liquid. |
| Specification: |
BAL (CAS NO.59-52-9), its Synonyms are 1,2-Dimercapto-3-propanol ; 1,2-Dithioglycerol ; 1-Propanol, 2,3-dimercapto ; 1-Propanol, 2,3-dimercapto- ; 2,3-Dimercapto-1-propanol ; 2,3-Dimercaptol-1-propanol ; 2,3-Dimercaptopropanol ; 2,3-Dithiopropanol ; 3-Hydroxy-1,2-propanedithiol ; Dimercaprol ; Glycerol, 1,2-dithio- . It is colourless oily liquid with a typically offensive mercaptan smell. |
| Report: |
EPA Genetic Toxicology Program. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29309070 |
| Storage Temperature: | 2-8°C |
| Sensitive: | Air Sensitive |
| Color: | Viscous oily liquid Colorless |
| Usage: | Anti-gas warfare agent. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
