| Identification | |
| Name: | Mercurate(1-),(4-carboxylatophenyl)chloro-, hydrogen |
| Synonyms: | Mercury,(p-carboxyphenyl)chloro- (8CI); (4-Carboxyphenyl)chloromercury;4-(Chloromercuri)benzoic acid; 4-Carboxyphenylmercuric chloride; NSC 32866;PCMB; p-(Chloromercuri)benzoic acid; p-Carboxyphenylmercuric chloride;p-Chlormercuribenzoic acid; p-Chloromercuric benzoic acid |
| CAS: | 59-85-8 |
| EINECS: | 200-442-6 |
| Molecular Formula: | C7H4 Cl Hg O2 . H |
| Molecular Weight: | 357.16 |
| InChI: | InChI=1/C7H5O2.ClH.Hg/c8-7(9)6-4-2-1-3-5-6;;/h2-5H,(H,8,9);1H;/q;;+1/p-1/rC7H5HgO2.ClH/c8-6-3-1-5(2-4-6)7(9)10;/h1-4H,(H,9,10);1H/q+1;/p-1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2025 6.1/PG 2 |
| Melting Point: | 287 °C (dec.)(lit.) |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: | White Solid usageEng:Can be used to inhibit some enzymes that require unmodified cysteine residues (e.g., adenylyl cyclase). Safety Statements:13-28-36-45-60-61 13:Keep away from food, drink and animal feeding stuffs 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Report: |
Reported in EPA TSCA Inventory. Mercury and its compounds are on the Community Right-To-Know List. |
| Packinggroup: | II |
| Flash Point: | °C |
| Storage Temperature: | -20?C Freezer |
| Usage: |
p-Chloromercuric benzoic acid (CAS NO.59-85-8) is a useful sulfhydryl reagent that reacts with Histidine 225C, a residue of the NhaA-Na/H Antiporter of Escherichia Coli. |
| Safety Data | |
 |
|
