| Identification | |
| Name: | 3-Methylbutyraldehyde |
| Synonyms: | Isovaleraldehyde; 3-Methylbutanal; Natural 3-Methylbutyraldehyde; Isoamyl aldehyde |
| CAS: | 590-86-3 |
| EINECS: | 209-691-5 |
| Molecular Formula: | C5H10O |
| Molecular Weight: | 86.13 |
| InChI: | InChI=1/C5H10O/c1-5(2)3-4-6/h4-5H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1989 |
| Density: | 0.796 |
| Stability: | Stable, but light and air sensitive. Highly flammable. Readily forms explosive mixtures with air. Incompatible with strong oxidizing agents, bases, reducing agents, air. |
| Refractive index: | 1.387-1.389 |
| Solubility: | 15 g/L (20 oC) in water |
| Appearance: | clear, colorless liquid. |
| Packinggroup: | II |
| HS Code: | 29121900 |
| Color: | Colorless liquid |
| Usage: | Flavor ingredient, fragrance ingredient in perfumes, chemical intermediate for isovaleric acid. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
