| Identification |
| Name: | 2-Butanone, 4-hydroxy- |
| Synonyms: | 1-Hydroxybutan-3-one;2-Hydroxyethyl methyl ketone;3-Ketobutan-1-ol;3-Ketobutanol;3-Oxo-1-butanol;3-Oxobutanol;4-Butanol-2-one;4-Hydroxy-2-butanone;Methylolacetone;Monomethylolacetone;NSC 41219; |
| CAS: | 590-90-9 |
| EINECS: | 209-693-6 |
| Molecular Formula: | C4H8O2 |
| Molecular Weight: | 88.11 |
| InChI: | InChI=1/C4H8O2/c1-4(6)2-3-5/h5H,2-3H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Flash Point: | 91? |
| Density: | 1.023 |
| Refractive index: | 1.430 |
| Solubility: | miscible with water, ethanol and ether |
| Appearance: | Colorless and transparent liquid |
| Flash Point: | 91? |
| Safety Data |
| |
 |
