| Identification |
| Name: | 2-butynoic acid |
| Synonyms: | Tetrolicacid (6CI,7CI,8CI); 1-Propynecarboxylic acid; 3-Methylpropiolic acid;Methylacetylenecarboxylic acid; Methylpropynoic acid; NSC 174116 |
| CAS: | 590-93-2 |
| EINECS: | 209-695-7 |
| Molecular Formula: | C4H4O2 |
| Molecular Weight: | 84.07 |
| InChI: | InChI=1/C4H4O2/c1-2-3-4(5)6/h1H3,(H,5,6) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3261 |
| Density: | 1.159 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Very soluble |
| Appearance: | White to yellow powder |
| Packinggroup: | II |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
