| Identification | |
| Name: | Methylmercury pentachlorophenate |
| Synonyms: | Mercury, methyl(pentachlorophenolato)- (9CI);BRN 3975229;Methylmercury pentachlorophenate;Methylmerkuripentachlorfenolat;Methylmerkuripentachlorfenolat [Czech];Stauffer MV242;Mercury, methyl(pentachlorophenoxy)-;Methyl(pentachlorophenolato)mercury;pentachlorophenol - methylmercury (1:1) |
| CAS: | 5902-76-1 |
| EINECS: | 227-596-7 |
| Molecular Formula: | C7H3Cl5HgO |
| Molecular Weight: | 481.9611 |
| InChI: | InChI=1/C6HCl5O.CH3.Hg/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h12H;1H3;/rC6HCl5O.CH3Hg/c7-1-2(8)4(10)6(12)5(11)3(1)9;1-2/h12H;1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 133.7°C |
| Boiling Point: | 309.5°C at 760 mmHg |
| Specification: |
Methylmercury pentachlorophenate (CAS NO.5902-76-1) is also named as BRN 3975229 ; Methylmerkuripentachlorfenolat ; Methylmerkuripentachlorfenolat [Czech] ; Stauffer MV242 ; Mercury, methylpentachlorophenolato)- (9CI) ; Mercury, methyl(pentachlorophenoxy)- ; Methyl(pentachlorophenolato)mercury . |
| Report: |
Mercury and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 133.7°C |
| Safety Data | |
 |
|
