| Identification | |
| Name: | 2,5-Furandione,3-(acetyloxy)dihydro-, (3S)- |
| Synonyms: | 2,5-Furandione,3-(acetyloxy)dihydro-, (S)-; (-)-Acetoxysuccinic anhydride;(S)-(-)-2-Acetoxysuccinic anhydride; (S)-Acetoxysuccinic anhydride;(S)-O-Acetylmalic acid anhydride |
| CAS: | 59025-03-5 |
| Molecular Formula: | C6H6 O5 |
| Molecular Weight: | 158.11 |
| InChI: | InChI=1/C6H6O5/c1-3(7)10-4-2-5(8)11-6(4)9/h4H,2H2,1H3/t4-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 54-56 °C(lit.) |
| Flash Point: | 133.093°C |
| Boiling Point: | 296.588°C at 760 mmHg |
| Density: | 1.386g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Sensitive to moisture. |
| Refractive index: | -25.5 ° (C=5, CHCl3) |
| Appearance: | solid |
| Specification: | White Crystalline Solid usageEng:Used as intermediates for detergents via O-acetylmalic acid amides. Regioselective ring opening of malic acid anhydrides by carbon nucleophiles Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 133.093°C |
| Sensitive: | Moisture Sensitive |
| Usage: |
(-)-O-Acetyl-L-malic Anhydride (CAS NO.80304-50-3) is used as intermediates for detergents via O-acetylmalic acid amides and regioselective ring opening of malic acid anhydrides by carbon nucleophiles. |
| Safety Data | |
 |
|
