| Identification | |
| Name: | 1-Acetylpiperidine-4-carbonyl chloride |
| Synonyms: | N-Acetylisonipecotoyl chloride |
| CAS: | 59084-16-1 |
| EINECS: | 261-594-7 |
| Molecular Formula: | C8H12ClNO2 |
| Molecular Weight: | 189.64 |
| InChI: | InChI=1/C8H12ClNO2/c1-6(11)10-4-2-7(3-5-10)8(9)12/h7H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3261 |
| Melting Point: | 135-137°C |
| Flash Point: | 140.1°C |
| Boiling Point: | 308°C at 760 mmHg |
| Density: | 1.224g/cm3 |
| Refractive index: | 1.496 |
| Appearance: | yellow powder |
| Specification: | Yellow Powder usageEng:A synthetic intermediate in the preparation of CNS depressants Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 140.1°C |
| Storage Temperature: | Hygroscopic, Refrigerator, Under Inert Atmosphere |
| Sensitive: | Moisture Sensitive |
| Usage: | A synthetic intermediate in the preparation of CNS depressants |
| Safety Data | |
 |
|
