| Identification | |
| Name: | 5-Pyrimidinecarboxylicacid, 4-chloro-2-(methylthio)-, ethyl ester |
| Synonyms: | 2-Methylthio-4-chloro-5-ethoxycarbonylpyrimidine;4-Chloro-2-methanethiopyrimidine-5-carboxylic acid ethyl ester;4-Chloro-2-methylsulfanylpyrimidine-5-carboxylic acid ethyl ester;4-Chloro-5-carbethoxy-2-methylthiopyrimidine;4-Chloro-5-ethoxycarbonyl-2-methylthiopyrimidine; |
| CAS: | 5909-24-0 |
| EINECS: | 227-619-0 |
| Molecular Formula: | C8H9ClN2O2S |
| Molecular Weight: | 232.69 |
| InChI: | InChI=1/C8H9ClN2O2S/c1-3-13-7(12)5-4-10-8(14-2)11-6(5)9/h4H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.37 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.568 |
| Appearance: | yellow white powdery crystal |
| Storage Temperature: | Keep Cold |
| Usage: |
Ethyl 4-chloro-2-methylthio-5-pyrimidinecarboxylate (CAS NO.5909-24-0) is used as inhibitor of Streptococcus faecium, Lactobacillus casei, and Pediococcus cerevisiae. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
