| Identification | |
| Name: | 2(3H)-Furanone,5-methyl- |
| Synonyms: | 3-Pentenoicacid, 4-hydroxy-, g-lactone (6CI,7CI);2,3-Dihydro-5-methylfuran-2-one;2-Oxo-5-methyl-2,3-dihydrofuran;4-Hydroxy-3-pentenoic acid g-lactone;4-Hydroxypent-3-enoicacid lactone;4-Methyl-2(3H)-furanone;5-Methyl-2,3-dihydro-2-furanone;5-Methylfuran-2(3H)-one;NSC 654;Pent-3-en-4-olide;D2-Angelica lactone;a-Angelica lactone;b,g-Angelica lactone;g-Angelica lactone; |
| CAS: | 591-12-8 |
| EINECS: | 209-701-8 |
| Molecular Formula: | C5H6O2 |
| Molecular Weight: | 98.1 |
| InChI: | InChI=1/C5H6O2/c1-4-2-3-5(6)7-4/h2H,3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.092 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.445-1.45 |
| Solubility: | 5 g/100 mL (25 oC) |
| Appearance: | Light yellow to green liquid. |
| Safety Data | |
 |
|
