| Identification | |
| Name: | 3-Bromophenol |
| Synonyms: | m-Bromophenol |
| CAS: | 591-20-8 |
| EINECS: | 209-706-5 |
| Molecular Formula: | C6H5BrO |
| Molecular Weight: | 173 |
| InChI: | InChI=1/C6H5BrO/c7-5-2-1-3-6(8)4-5/h1-4,8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | >230 °F |
| Density: | 1.63 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.595-1.599 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | White to off-white solid. |
| Packinggroup: | III |
| HS Code: | 29081000 |
| Flash Point: | >230 °F |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Crystals |
| Usage: | Inhibitor of enzyme |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
