| Identification | |
| Name: | Cyclohexanol, 3-methyl- |
| Synonyms: | 3-Methyl-1-cyclohexanol;3-Methylcyclohexanol; NSC 123022 |
| CAS: | 591-23-1 |
| EINECS: | 209-709-1 |
| Molecular Formula: | C7H14 O |
| Molecular Weight: | 114.18 |
| InChI: | InChI=1/C7H14O/c1-6-3-2-4-7(8)5-6/h6-8H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 33557 |
| Density: | 0.91 |
| Refractive index: | n20/D 1.458(lit.) |
| Specification: | CLEAR COLOURLESS TO PALE YELLOW LIQUID Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | O53 |
| Safety Data | |
 |
|
