| Identification | |
| Name: | Cyclohexanone,3-methyl- |
| CAS: | 591-24-2 |
| EINECS: | 209-710-7 |
| Molecular Formula: | C7H12 O |
| Molecular Weight: | 112.16958 |
| InChI: | InChI=1S/C7H12O/c1-6-3-2-4-7(8)5-6/h6H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 190kgs |
| Melting Point: | -73 °C |
| Flash Point: | 48 C |
| Boiling Point: | 169 - 170 C |
| Density: | 0.912g/cm3 |
| Refractive index: | n20/D 1.446(lit.) |
| Water Solubility: | immiscible |
| Solubility: | immiscible |
| Specification: | CLEAR COLOURLESS TO VERY SLIGHTLY YELLOW LIQUID Safety Statements:36/37-23-16 36/37:Wear suitable protective clothing and gloves 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 16:Keep away from sources of ignition - No smoking |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 48 C |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
3 (Packing Group: III)
|
 |
|
