| Identification |
| Name: | 2-Hexanone |
| Synonyms: | n-Butyl methyl ketone; MBK; Methyl n-butyl ketone; Methyl butyl ketone; Butyl methyl ketone; Methyl buthyl ketone; MNBK |
| CAS: | 591-78-6 |
| EINECS: | 209-731-1 |
| Molecular Formula: | C6H12O |
| Molecular Weight: | 100.16 |
| InChI: | InChI=1/C6H12O/c1-3-4-5-6(2)7/h3-5H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1224 |
| Density: | 0.81 |
| Stability: | Stable. Flammable. Incompatible with oxidizing agents, strong bases, reducing agents. |
| Refractive index: | 1.3995-1.4015 |
| Solubility: | 14
(g/l) |
| Appearance: | colorless to pale yellow liquid |
| Packinggroup: | II |
| Color: | Colorless liquid |
| Usage: | Solvent for lacquers, ink thinners, nitrocellulose, resins, oils, fats and waxes. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
