Identification |
Name: | 1,4,5,8,9,10-Hexahydroanthracene |
Synonyms: | anthracene, 1,4,5,8,9,10-hexahydro-; |
CAS: | 5910-28-1 |
EINECS: | 227-621-1 |
Molecular Formula: | C14H16 |
Molecular Weight: | 184.28 |
InChI: | InChI=1/C14H16/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-4H,5-10H2 |
Molecular Structure: |
|
Properties |
Melting Point: | 147-150 ºC |
Flash Point: | 120.4°C |
Boiling Point: | 315.2°Cat760mmHg |
Density: | 1.04g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.59 |
Solubility: | Insoluble |
Appearance: | Clear yellow liquid. Nutty, cocoa odor. |
Packinggroup: | I; II; III |
Flash Point: | 120.4°C |
Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
Safety Data |
|
|