| Identification | |
| Name: | Urea, N-butyl- |
| Synonyms: | Urea,butyl- (6CI,7CI,8CI,9CI); 1-Butylurea; Butylurea; N-Butylurea; NSC 2597 |
| CAS: | 592-31-4 |
| EINECS: | 209-748-4 |
| Molecular Formula: | C5H12 N2 O |
| Molecular Weight: | 116.16 |
| InChI: | InChI=1/C5H12N2O/c1-2-3-4-7-5(6)8/h2-4H2,1H3,(H3,6,7,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.962 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. Decomposes when heated. |
| Refractive index: | 1.449 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Specification: |
N-Butylurea (CAS NO.592-31-4) is a white to almost white crystalline powder.And it can soluble in water.It is an amide. Amides/imides react with azo and diazo compounds to generate toxic gases. Flammable gases are formed by the reaction of organic amides/imides with strong reducing agents. Amides are very weak bases (weaker than water). Imides are less basic yet and in fact react with strong bases to form salts. That is, they can react as acids. Mixing amides with dehydrating agents such as P2O5 or SOCl2 generates the corresponding nitrile. The combustion of these compounds generates mixed oxides of nitrogen (NOx). N-Butylurea decomposes on heating. N-Butylurea emits toxic fumes when heated to decomposition. It is probably combustible. |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Storage Temperature: | Keep containers tightly closed. Store in a cool, dry area away from incompatible substances. |
| Color: | TABLETS FROM WATER; NEEDLES FROM BENZENE WHITE SOLID |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
