| Identification | |
| Name: | Phenol,3-(3-ethylhexahydro-1-methyl-1H-azepin-3-yl)-, hydrochloride (1:1) |
| Synonyms: | Phenol,3-(3-ethylhexahydro-1-methyl-1H-azepin-3-yl)-, hydrochloride (9CI);IL 22811HCl;Meptamizol hydrochloride;Meptazinol hydrochloride;Meptid;Wy 22811;Wy22811 HCl; |
| CAS: | 59263-76-2 |
| EINECS: | 261-683-0 |
| Molecular Formula: | C15H23NO.HCl |
| Molecular Weight: | 269.81 |
| InChI: | InChI=1/C15H23NO.ClH/c1-3-15(9-4-5-10-16(2)12-15)13-7-6-8-14(17)11-13;/h6-8,11,17H,3-5,9-10,12H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 160.6°C |
| Boiling Point: | 354.8°C at 760 mmHg |
| Appearance: | White solid |
| Specification: | White Solid usageEng:Mixed opioid agonist-antagonist. Analgesic (narcotic) |
| Biological Activity: | Centrally active opioid analgesic. Partial agonist at the μ 1 opioid receptor. Also shown to inhibit acetylcholinesterase. |
| Flash Point: | 160.6°C |
| Usage: |
Meptazinol hydrochloride (CAS NO.59263-76-2) is used as centrally active opioid analgesic. |
| Safety Data | |
 |
|
