| Identification | |
| Name: | acycloguanosine |
| Synonyms: | aciclovir; Acyclovir (Patented-No Supply); N(9)-Oxyethoxymethylguanine (Acyclovir); Acyclovir; 9-[(2-Hydroxyethoxy)methyl]guanine |
| CAS: | 59277-89-3 |
| EINECS: | 261-685-1 |
| Molecular Formula: | C8H11N5O3 |
| Molecular Weight: | 225.20464 |
| InChI: | InChI=1S/C8H11N5O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h3,14H,1-2,4H2,(H3,9,11,12,15) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.77 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Water solubility: 0.7 mg/mL |
| Solubility: | Water solubility: 0.7 mg/mL |
| Appearance: | White to light yellow crystal powder |
| Specification: |
?Acyclovir , its cas register number is 59277-89-3. It also can be called 9-[(2-Hydroxyethoxy)methyl]guanine ; 2-Amino-1,9-dihydro-9-((2-hydroxyethoxy)methyl)-6H-purin-6-one ; and Acycloguanosine . It?is commonly marketed as tablets (200 mg, 400 mg, 800 mg and 1 gram), topical cream (5%), intravenous injection (25 mg/mL) and ophthalmic ointment (3%). |
| Color: | white |
| Usage: | Orally active acyclic nucleoside with inhibitory activity towards several herpes viruses. Antiviral |
| Safety Data | |
 |
|
