| Identification | |
| Name: | Hydrazine,1,1-dimethyl-, monohydrochloride (9CI) |
| Synonyms: | 1,1-Dimethylhydrazinehydrochloride;N,N-Dimethylhydrazine hydrochloride |
| CAS: | 593-82-8 |
| EINECS: | 209-811-6 |
| Molecular Formula: | C2H8 N2 . Cl H |
| Molecular Weight: | 96.58 |
| InChI: | InChI=1/C2H8N2.ClH/c1-4(2)3;/h3H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Melting Point: | 85°C |
| Flash Point: | 1.1°C |
| Boiling Point: | 63.9°Cat760mmHg |
| Density: | 0.829g/cm3 |
| Solubility: | Very sol in methanol and ethanol >10% in water Miscible with dimethylformamide, hydrocarbons, alcohol, ether Miscible in water at 25 deg C |
| Specification: | Safety Statements:22-36/37/39-45 22:Do not breathe dust 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 1.1°C |
| Color: | CLEAR, COLORLESS LIQUID Colorless liquid |
| Safety Data | |
 |
|
