| Identification | |
| Name: | Arsine, trimethyl- |
| Synonyms: | Trimethylarsenic;Trimethylarsine |
| CAS: | 593-88-4 |
| EINECS: | 209-815-8 |
| Molecular Formula: | C3H9 As |
| Molecular Weight: | 120.02516 |
| InChI: | InChI=1S/C3H9As/c1-4(2)3/h1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1992 |
| Melting Point: | -87,3ºC |
| Flash Point: | 100ºC |
| Boiling Point: | 53.8ºC at 760 mmHg |
| Density: | g/cm3 |
| Water Solubility: | slightly soluble in Water |
| Solubility: | slightly soluble in Water |
| Appearance: | Colorless liquid |
| Specification: | Safety Statements:3/7-9-23-45-61-60-28-20/21 3/7:Keep container tightly closed in a cool place 9:Keep container in a well-ventilated place 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet 60:This material and/or its container must be disposed of as hazardous waste 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 20/21:When using, do not eat, drink or smoke |
| Report: |
Arsenic and its compounds are on the Community Right-To-Know List. |
| Packinggroup: | I |
| Flash Point: | 100ºC |
| Safety Data | |
| Hazard Symbols |
T: Toxic
N: Dangerous for the environment
T: Toxic
|
 |
|
