Identification |
Name: | 1,3,2-Dioxaselenolane,4,4,5,5-tetramethyl-, 2-oxide |
Synonyms: | 2,3-Butanediol,2,3-dimethyl-, cyclic ester with selenious acid (H2SeO3) (8CI); 2,3-Butanediol,2,3-dimethyl-, cyclic selenite (7CI); NSC 316451; Tetramethylethylene selenite |
CAS: | 5930-83-6 |
Molecular Formula: | C6H12 O3 Se |
Molecular Weight: | 211.1177 |
InChI: | InChI=1/C19H23NO5/c1-12(2)25-15-9-7-6-8-14(15)20-19(21)13-10-16(22-3)18(24-5)17(11-13)23-4/h6-12H,1-5H3,(H,20,21) |
Molecular Structure: |
 |
Properties |
Flash Point: | °C |
Boiling Point: | 53.7°Cat760mmHg |
Density: | g/cm3 |
Refractive index: | 1.563 |
Flash Point: | °C |
Safety Data |
|
 |