Identification |
Name: | 6-Nonenoic acid,8-methyl-, (6E)- |
Synonyms: | 6-Nonenoicacid, 8-methyl-, (E)-;8-Methylnon-trans-6-enoic acid;trans-8-Methylnon-6-enoic acid; |
CAS: | 59320-77-3 |
Molecular Formula: | C10H18O2 |
Molecular Weight: | 170.25 |
InChI: | InChI=1S/C10H18O2/c1-9(2)7-5-3-4-6-8-10(11)12/h5,7,9H,3-4,6,8H2,1-2H3,(H,11,12)/b7-5+ |
Molecular Structure: |
 |
Properties |
Density: | 0.934 g/cm3 |
Appearance: | yellow oil |
Specification: | Yellow Oil usageEng:A compund from thermal decomposition of Capsaicin, as a possible carcinogen. E/Z = 88/12 (by NMR) |
Storage Temperature: | Refrigerator, Under Inert Atmosphere |
Usage: | A compund from thermal decomposition of Capsaicin, as a possible carcinogen. E/Z = 88/12 (by NMR) |
Safety Data |
|
 |