Identification |
Name: | 4H-Imidazo[1,5-a][1,4]benzodiazepin-4-ol,8-chloro-6-(2-fluorophenyl)-1-methyl- |
Synonyms: | 4-Hydroxymidazolam |
CAS: | 59468-85-8 |
EINECS: | 200-323-9 |
Molecular Formula: | C18H13 Cl F N3 O |
Molecular Weight: | 258.4 |
InChI: | InChI=1/C18H13ClFN3O/c1-10-21-9-16-18(24)22-17(12-4-2-3-5-14(12)20)13-8-11(19)6-7-15(13)23(10)16/h2-9,18,24H,1H3 |
Molecular Structure: |
|
Properties |
Melting Point: | 186-187 °C
|
Flash Point: | 286.8°C |
Boiling Point: | 550.6°C at 760 mmHg |
Density: | 1.44g/cm3 |
Refractive index: | 1.688 |
Flash Point: | 286.8°C |
Storage Temperature: | 2-8°C |
Color: | white to off-white |
Usage: | A metabolite of Midazolam |
Safety Data |
|
|