| Identification | |
| Name: | Oxirane,2-(4-nitrophenoxy)- |
| Synonyms: | Oxirane,(4-nitrophenoxy)- (9CI); (4-Nitrophenoxy)oxirane |
| CAS: | 59485-08-4 |
| Molecular Formula: | C8H7 N O4 |
| Molecular Weight: | 181.16 |
| InChI: | InChI=1/C8H7NO4/c10-9(11)6-1-3-7(4-2-6)13-8-5-12-8/h1-4,8H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 180.8°C |
| Boiling Point: | 342.7°C at 760 mmHg |
| Density: | 1.442g/cm3 |
| Refractive index: | 1.612 |
| Specification: |
(4-Nitrophenoxy)oxirane with cas registry number of 59485-08-4 is also called for 2'-(4-Nitrophenoxy)oxirane ; CCRIS 8088 ; Oxirane, (4-nitrophenoxy)- . |
| Flash Point: | 180.8°C |
| Safety Data | |
 |
|
