| Identification | |
| Name: | Adenosine, 2-azido- |
| Synonyms: | 2-Azido-D-adenosine;2-Azidoadenosine; NSC 36905 |
| CAS: | 59587-07-4 |
| Molecular Formula: | C10H12 N8 O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H12N8O4/c11-7-4-8(15-10(14-7)16-17-12)18(2-13-4)9-6(21)5(20)3(1-19)22-9/h2-3,5-6,9,19-21H,1H2,(H2,11,14,15)/t3-,5-,6-,9-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Appearance: | Off-white to grey solid |
| Specification: | Off-White to Grey Solid usageEng:A useful synthetic intermediate for making potent and selective coronary vasodilators |
| Usage: | A useful synthetic intermediate for making potent and selective coronary vasodilators |
| Safety Data | |
 |
|
