| Identification | |
| Name: | 1-Naphthalenol,4-amino-, hydrochloride (1:1) |
| Synonyms: | 1-Naphthalenol,4-amino-, hydrochloride (9CI); 1-Naphthol, 4-amino-, hydrochloride (8CI);4-Amino-1-naphthol hydrochloride; 4-Aminonaphth-1-ol hydrochloride;4-Aminonaphthalen-1-ol hydrochloride |
| CAS: | 5959-56-8 |
| EINECS: | 227-727-8 |
| Molecular Formula: | C10H9 N O . Cl H |
| Molecular Weight: | 195.65 |
| InChI: | InChI=1/C10H9NO.ClH/c11-9-5-6-10(12)8-4-2-1-3-7(8)9;/h1-6,12H,11H2;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 187.8°C |
| Boiling Point: | 386.8°C at 760 mmHg |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | Grey powder. |
| Specification: | pink to grey powder Safety Statements:26-37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 187.8°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
