Identification |
Name: | 2,4,8,10-Tetraoxaspiro[5.5]undecane-3,9-dioctanoicacid |
Synonyms: | Azelaaldehydicacid, cyclic diacetal with pentaerythritol; Azelaaldehydic acid, cyclicneopentanetetrayl acetal |
CAS: | 5961-76-2 |
Molecular Formula: | C23H40 O8 |
Molecular Weight: | 473.5435 |
InChI: | InChI=1/C26H23N3O4S/c1-4-33-25(31)22-15(2)28-26-29(23(22)16-8-7-9-18(12-16)32-3)24(30)21(34-26)13-17-14-27-20-11-6-5-10-19(17)20/h5-14,23,27H,4H2,1-3H3/b21-13- |
Molecular Structure: |
![(C23H40O8) Azelaaldehydicacid, cyclic diacetal with pentaerythritol; Azelaaldehydic acid, cyclicneopentanetetra...](https://img1.guidechem.com/chem/e/dict/50/5961-76-2.jpg) |
Properties |
Flash Point: | 355.9°C |
Boiling Point: | 665°Cat760mmHg |
Density: | 1.36g/cm3 |
Refractive index: | 1.68 |
Flash Point: | 355.9°C |
Safety Data |
|
![](/images/detail_15.png) |