Identification |
Name: | Cobalt,diaqua[ethanedioato(2-)-kO1,kO2]-, (T-4)- |
Synonyms: | Cobalt,diaqua[ethanedioato(2-)-O,O']-, (T-4)-;Oxalic acid, cobalt(2+) salt (1:1),dihydrate (8CI);Cobalt oxalate (1:1), dihydrate;Cobalt oxalate (CoC2O4)dihydrate;Cobalt oxalate, dihydrate;Cobalt(2+) oxalate dihydrate;Cobaltousoxalate (1:1) dihydrate;Cobaltous oxalate dihydrate; |
CAS: | 5965-38-8 |
EINECS: | 212-409-3 |
Molecular Formula: | C2H4CoO6 |
Molecular Weight: | 352.79272 |
InChI: | InChI=1S/C15H13ClN2O4S/c1-3-4-18-14(21)9(13(20)17-15(18)23)5-8-6-10(16)12(19)11(7-8)22-2/h3,5-7,19H,1,4H2,2H3,(H,17,20,23)/b9-5- |
Molecular Structure: |
|
Properties |
Transport: | UN3288 |
Density: | 3.021 |
Refractive index: | 1.682 |
Water Solubility: | soluble in ammonia,slightly soluble in water and acid |
Solubility: | soluble in ammonia,slightly soluble in water and acid |
Appearance: | Light pink crystals |
Packinggroup: | III |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
|