| Identification | |
| Name: | 1,1'-Biphenyl, 4-hexyl- |
| Synonyms: | Biphenyl,4-hexyl- (6CI); 4-Hexylbiphenyl |
| CAS: | 59662-31-6 |
| EINECS: | 261-845-0 |
| Molecular Formula: | C18H22 |
| Molecular Weight: | 238.37 |
| InChI: | InChI=1/C18H22/c1-2-3-4-6-9-16-12-14-18(15-13-16)17-10-7-5-8-11-17/h5,7-8,10-15H,2-4,6,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 29 °C |
| Flash Point: | >110°C |
| Boiling Point: | 175-177 °C (3 mmHg) |
| Density: | 0,988 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5579 (34 C) |
| Solubility: | Insoluble |
| Appearance: | White to pale yellow solid. |
| Specification: |
1,1'-Biphenyl, 4-hexyl- (CAS NO.59662-31-6) is also called as EINECS 261-845-0 ; 4-Hexyl-1,1'-biphenyl ; 4-Hexylbiphenyl ; 4-N-hexylbiphenyl ; 4-N-hexylbiphenyl,99% ; 1,1'-Biphenyl, 4-hexyl- ; 1-Hexyl-4-phenylbenzene ; 4-Hexylbiphenyl,99% . |
| Flash Point: | >110°C |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: |
1,1'-Biphenyl, 4-hexyl- (CAS NO.59662-31-6) can be used as intermediates of liquid crystals. |
| Safety Data | |
 |
|
