| Identification | |
| Name: | Thiodicarb |
| Synonyms: | Bis[1-methylthioacetaldehyde-O-(N-methylcarbamoyl)oximino]sulfide; Dimethyl N,N'-[thiobis[(methylimino)carbonyloxy]]bis(thioimidoacetate); N,N'-[Thiobis[(methylimino)carbonyloxy]]bis-ethanimidothioic acid dimethyl ester |
| CAS: | 59669-26-0 |
| EINECS: | 261-848-7 |
| Molecular Formula: | C10H18N4O4S3 |
| Molecular Weight: | 354.46932 |
| InChI: | InChI=1S/C10H18N4O4S3/c1-7(19-5)11-17-9(15)13(3)21-14(4)10(16)18-12-8(2)20-6/h1-6H3 |
| Molecular Structure: | ![(C10H18N4O4S3) Bis[1-methylthioacetaldehyde-O-(N-methylcarbamoyl)oximino]sulfide; Dimethyl N,N'-[thiobis[(methylimi...](https://img1.guidechem.com/structure/image/59669-26-0.jpg) |
| Properties | |
| Transport: | 2757 |
| Density: | 1.31 g/cm3 |
| Refractive index: | 1.575 |
| Appearance: | White crystalline powder |
| Specification: | Safety Statements:28-36/37-45 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37:Wear suitable protective clothing and gloves 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Storage Temperature: | 0-6°C |
| Color: | Colorless crystals White to light tan crystalline powder (solid) White crystals |
| Safety Data | |
| Hazard Symbols |
T+: Very toxic
|
 |
|
