| Identification | |
| Name: | Sodium carbonate, monohydrate |
| Synonyms: | carbonic acid, sodium salt, hydrate (1:2:1);Disodium carbonate monohydrate;Sodium carbonate hydrate (2:1:1); |
| CAS: | 5968-11-6 |
| EINECS: | 207-838-8 |
| Molecular Formula: | CH2Na2O4 |
| Molecular Weight: | 124.00372 |
| InChI: | InChI=1S/CH2O3.2Na.H2O/c2-1(3)4;;;/h(H2,2,3,4);;;1H2/q;2*+1;/p-2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 2.53g/cm3 |
| Stability: | Stable. Incompatible with strong acids, aluminium, fluorine, lithium, phosphorus oxides. |
| Appearance: | white powder |
| Specification: | white powder Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
