| Identification | |
| Name: | 2-Propen-1-ol,2-chloro- (6CI,7CI,8CI,9CI) |
| Synonyms: | 2-Chloro-1-prop-2-en-1-ol;2-Chloro-2-propen-1-ol; 2-Chloro-2-propenol; 2-Chloro-3-hydroxypropene;2-Chloroallyl alcohol; NSC 508743; NSC 87536; b-Chloroallyl alcohol |
| CAS: | 5976-47-6 |
| Molecular Formula: | C3H5 Cl O |
| Molecular Weight: | 92.53 |
| InChI: | InChI=1/C3H5ClO/c1-3(4)2-5/h5H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2920 8/PG 2 |
| Flash Point: | 130 °F |
| Boiling Point: | 133-134 °C(lit.) |
| Density: | 1.162 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.459(lit.) |
| Specification: | Safety Statements:16-26-27-36/37/39 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 130 °F |
| Safety Data | |
 |
|
