| Identification | |
| Name: | 4-Hydroxyestradiol |
| Synonyms: | 3,4,17BETA-TRIHYDROXY-1,3,5[10]-ESTRATRIENE;1,3,5[10]-ESTRATRIENE-3,4,17BETA-TRIOL;1,3,5(10)-ESTRATRIEN-3,4,17-BETA-TRIOL;4-HYDROXY 17-BETA-ESTRADIOL;4-HYDROXYESTRADIOL;4-hydroxyestradiol-17beta;4-oh-estradiol;estra-1,3,5(10)-triene-3,4,17-beta-triol |
| CAS: | 5976-61-4 |
| Molecular Formula: | C18H24O3 |
| Molecular Weight: | 288.38 |
| InChI: | InChI=1/C18H24O3/c1-18-9-8-11-10-4-6-15(19)17(21)13(10)3-2-12(11)14(18)5-7-16(18)20/h4,6,11-12,14,16,19-21H,2-3,5,7-9H2,1H3/t11-,12-,14+,16+,18+/m1/s1 |
| Molecular Structure: | ![(C18H24O3) 3,4,17BETA-TRIHYDROXY-1,3,5[10]-ESTRATRIENE;1,3,5[10]-ESTRATRIENE-3,4,17BETA-TRIOL;1,3,5(10)-ESTRATR...](https://img.guidechem.com/crawlimg/5976-61-4.png) |
| Properties | |
| Flash Point: | 220.6°C |
| Boiling Point: | 468.6°C at 760 mmHg |
| Density: | 1.248g/cm3 |
| Refractive index: | 1.622 |
| Specification: | Light Brown Solid usageEng:A metabolite of Estradiol Safety Statements:22-36 22:Do not breathe dust 36:Wear suitable protective clothing |
| Flash Point: | 220.6°C |
| Storage Temperature: | −20°C |
| Usage: |
4-Hydroxyestradiol (CAS NO.5976-61-4) is used as metabolite of Estradiol . |
| Safety Data | |
 |
|
