| Identification | |
| Name: | Arsonous dichloride,As-ethyl- |
| Synonyms: | Arsenic dichloroethane;Arsine,dichloroethyl-;Arsonous dichloride,ethyl-;Ethyldichloroarsine;Ethylarsonous dichloride;Ethyldichlorarsine;Dichloroethylarsine;Arsine,dichloroethyl-;HSDB 424 |
| CAS: | 598-14-1 |
| EINECS: | 209-919-3 |
| Molecular Formula: | C2H5 As Cl2 |
| Molecular Weight: | 174.89 |
| InChI: | InChI=1/C2H5AsCl2/c1-2-3(4)5/h2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 61098 |
| Melting Point: | -65 |
| Flash Point: | 55.6°C |
| Boiling Point: | 159.8°Cat760mmHg |
| Density: | g/cm3 |
| Solubility: | Soluble in alcohol, benzene, ether, and water. |
| Specification: |
Ethyldichloroarsine ,its CAS NO. is 598-14-1,the synonyms is Arsenic dichloroethane ; Arsine, dichloroethyl- ; Arsonous dichloride, ethyl- ; BRN 1731722 ; Dichloroethylarsine ; EINECS 209-919-3 ; Ethylarsonous dichloride ; Ethyldichloroarsine ; Arsonous dichloride, As-ethyl- ; Dichloro(ethyl)arsine . |
| Report: |
Arsenic and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 55.6°C |
| Color: | Colorless, mobile liquid |
| Safety Data | |
| Hazard Symbols | |
 |
|
