| Identification | |
| Name: | Ethanol, 2,2-dichloro- |
| Synonyms: | 2,2-Dichloroethanol;Dichloroethanol; NSC 60513 |
| CAS: | 598-38-9 |
| EINECS: | 209-931-9 |
| Molecular Formula: | C2H4 Cl2 O |
| Molecular Weight: | 114.96 |
| InChI: | InChI=1/C2H4Cl2O/c3-2(4)1-5/h2,5H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.398 g/cm1.398 g/cm3 |
| Stability: | Stable. Combustible. Incompatible with oxidizing agents. |
| Refractive index: | n20/D 1.473(lit.) |
| Appearance: | colourless to light yellow liquid |
| Specification: |
2,2-Dichloroethanol ,its cas register number is 598-38-9. It also can be called Ethanol, 2,2-dichloro- . 2,2-Dichloroethanol (CAS NO.598-38-9) is incompatible with oxidizing agents. |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
