| Identification |
| Name: | Toluene sulfonyl chloride |
| Synonyms: | Ethylamine,N,N-dimethyl- (6CI,7CI,8CI); DMEA; Dimethylethylamine; Methanamine,N-ethyl-N-methyl-; N,N-Dimethylaminoethane; N,N-Dimethylethanamine;N,N-Dimethylethylamine; N-Ethyldimethylamine |
| CAS: | 598-56-1 |
| EINECS: | 209-940-8 |
| Molecular Formula: | C4H11N |
| Molecular Weight: | 73.14 |
| InChI: | InChI=1/C4H11N/c1-4-5(2)3/h4H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2733 3 |
| Density: | 0.675 |
| Stability: | Stable. Extremely flammable - note low flash point. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.3715-1.3735 |
| Water Solubility: | SOLUBLE |
| Solubility: | Soluble in water,miscible with most common organic solven |
| Appearance: | colorless liquid |
| Packinggroup: | I |
| HS Code: | 29211980 |
| Storage Temperature: | Flammables area |
| Color: | Liquid |
| Usage: | As curing catalyst for resin bonding of sand cores. |
| Safety Data |
| Hazard Symbols |
F+:Highlyflammable
C:Corrosive
|
| |
 |
