| Identification | |
| Name: | 2-Propenoic acid, 2-methyl-, polymer with butyl 2-propenoate and N-(hydroxymethyl)-2-propenamide |
| Synonyms: | AC1O588P;Butyl acrylate, N-methylolacrylamide, methacrylic acid polymer;Butyl acrylate, N-methylol acrylamide, methacrylic acid polymer;butyl prop-2-enoate; N-(hydroxymethyl)prop-2-enamide; 2-methylprop-2-enoic acid;2-Propenoic acid, 2-methyl-, polymer with butyl 2-propenoate and N-(hydroxymethyl)-2-propenamide;59822-58-1 |
| CAS: | 59822-58-1 |
| Molecular Formula: | C15H25NO6 |
| Molecular Weight: | 315.3621 |
| InChI: | InChI=1S/C7H12O2.C4H7NO2.C4H6O2/c1-3-5-6-9-7(8)4-2;1-2-4(7)5-3-6;1-3(2)4(5)6/h4H,2-3,5-6H2,1H3;2,6H,1,3H2,(H,5,7);1H2,2H3,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 39.4°C |
| Boiling Point: | 145.9°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 39.4°C |
| Safety Data | |
 |
|
