| Identification | |
| Name: | Benoxinate hydrochloride |
| Synonyms: | Benoxinate Hydrochloride; |
| CAS: | 5987-82-6 |
| EINECS: | 227-808-8 |
| Molecular Formula: | C17H28N2O3 . ClH |
| Molecular Weight: | 344.88 |
| InChI: | InChI=1/C17H28N2O3.ClH/c1-4-7-11-21-16-13-14(8-9-15(16)18)17(20)22-12-10-19(5-2)6-3;/h8-9,13H,4-7,10-12,18H2,1-3H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Melting Point: | 158 - 162 C |
| Appearance: | White crystalline powder |
| Specification: | crystals Safety Statements:22-26-36 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29225000 |
| Safety Data | |
 |
|
