| Identification | |
| Name: | 1-(Cyclopropylcarbonyl)piperazine |
| Synonyms: | Piperazine,1-(cyclopropylcarbonyl)- (9CI);1-Cyclopropanoylpiperazine;1-Cyclopropylcarbonylpiperazine;Cyclopropyl(piperazin-1-yl)methanone;N-(Cyclopropylcarbonyl)piperazine;Methanone, cyclopropyl-1-piperazinyl-; |
| CAS: | 59878-57-8 |
| Molecular Formula: | C8H14N2O |
| Molecular Weight: | 154.20956 |
| InChI: | InChI=1/C8H14N2O/c11-8(7-1-2-7)10-5-3-9-4-6-10/h7,9H,1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.15 g/cm3 |
| Refractive index: | n20/D 1.524 |
| Specification: |
The 1-(Cyclopropylcarbonyl)piperazine with the cas number 59878-57-8, is also called cyclopropyl(piperazin-1-yl)methanone. This chemical belongs to the following product categories: (1)PIPERIDINE; (2)Acids and Derivatives; (3)Amines and Anilines; (4)API intermediates; (5)Building Blocks; (6)Heterocyclic Building Blocks; (7)Piperazines. The properties of the chemical are: (1)ACD/LogP: -0.41; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -2.18; (4)ACD/LogD (pH 7.4): -0.65; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 8.1; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 23.55Å2; (13)Index of Refraction: 1.535; (14)Molar Refractivity: 41.76 cm3; (15)Molar Volume: 134 cm3; (16)Polarizability: 16.55×10-24cm3; (17)Surface Tension: 45.9 dyne/cm; (18)Enthalpy of Vaporization: 54.59 kJ/mol; (19)Vapour Pressure: 0.00082 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
