| Identification | |
| Name: | Nitrosochloroethyldimethylurea |
| Synonyms: | Urea, N- (2-chloroethyl)-N',N'-dimethyl-N-nitroso- |
| CAS: | 59960-30-4 |
| Molecular Formula: | C5H10ClN3O2 |
| Molecular Weight: | 179.6048 |
| InChI: | InChI=1/C5H10ClN3O2/c1-8(2)5(10)9(7-11)4-3-6/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 88.3°C |
| Boiling Point: | 222.4°C at 760 mmHg |
| Density: | 1.27g/cm3 |
| Refractive index: | 1.512 |
| Specification: |
Nitrosochloroethyldimethylurea , its cas register number is 59960-30-4. It also can be called 1-Nitroso-1-(2-chloroethyl)-3,3-dimethylurea ; BRN 2255038 ; and Urea, 1-(2-chloroethyl)-3,3-dimethyl-1-nitroso- . |
| Flash Point: | 88.3°C |
| Safety Data | |
 |
|
