| Identification | |
| Name: | Dihydro Ketoprofen (Mixture of Diastereomers) |
| CAS: | 59960-32-6 |
| Molecular Formula: | C16H16O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C16H16O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11,15,17H,1H3,(H,18,19) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 230.2°C |
| Boiling Point: | 433.6°C at 760 mmHg |
| Density: | 1.21g/cm3 |
| Refractive index: | 1.604 |
| Specification: | Pale Yellow Solid usageEng:A metabolite of Ketoprofen |
| Flash Point: | 230.2°C |
| Storage Temperature: | Refrigerator |
| Usage: | A metabolite of Ketoprofen |
| Safety Data | |
 |
|
