| Identification | |
| Name: | Butanoic acid,1,2,3-propanetriyl ester |
| Synonyms: | Butyrin,tri- (6CI,8CI);Butyryl triglyceride;Glycerin tributyrate;Glyceroltributanoate;Glycerol tributyrate;Glyceroltributyrin;Glyceryl tributanoate;Glyceryl tributyrate;NSC 661583;Tri-n-butyrin;Tributanoin;Tributin;Tributyrin;Tributyroin;Tributyryl glyceride;Tributyrylglycerol; |
| CAS: | 60-01-5 |
| EINECS: | 200-451-5 |
| Molecular Formula: | C15H26O6 |
| Molecular Weight: | 302.36334 |
| InChI: | InChI=1S/C15H26O6/c1-4-7-13(16)19-10-12(21-15(18)9-6-3)11-20-14(17)8-5-2/h12H,4-11H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.0335 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.448 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Not hazardous according to Directive 67/548/EEC. Toxicity data (The meaning of any toxico |
| Solubility: |
|
| Appearance: | colourless liquid |
| Specification: | colourless liquid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Storage Temperature: | Store at RT. |
| Color: | COLORLESS Oily liquid |
| Safety Data | |
 |
|
