| Identification | |
| Name: | 1-Phenyl-2-propylamine |
| Synonyms: | 3-AMINO-1-PROPYLBENZENE;3-propylaniline |
| CAS: | 60-15-1 |
| EINECS: | 200-458-3 |
| Molecular Formula: | C9H13N |
| Molecular Weight: | 135.21 |
| InChI: | InChI=1/C9H13N/c1-2-4-8-5-3-6-9(10)7-8/h3,5-7H,2,4,10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 98.7°C |
| Boiling Point: | 234.7°C at 760 mmHg |
| Density: | 0.958g/cm3 |
| Refractive index: | 1.546 |
| Solubility: | Sparingly sol in water (1:50) SOL IN DIETHYL ETHER, ETHANOL Slightly sol in water; sol in alc, ether; readily sol in acids. Slightly soluble in water and ethyl ether; soluble in ethanol and chloroform. |
| Flash Point: | 98.7°C |
| Color: | Mobile liquid Colorless, volatile liquid |
| Safety Data | |
 |
|
