| Identification | |
| Name: | 4H-Imidazol-4-one,2-amino-1,5-dihydro-1-methyl- |
| Synonyms: | Creatinine(8CI);1-Methylglycocyamidine;1-Methylhydantoin-2-imide;2-Amino-1-methyl-1,5-dihydroimidazol-4-one;2-Amino-1-methylimidazolin-4-one;NSC 13123;TEGO Cosmo C 250; |
| CAS: | 60-27-5 |
| EINECS: | 200-466-7 |
| Molecular Formula: | C4H7N3O |
| Molecular Weight: | 113.12 |
| InChI: | InChI=1/C4H7N3O/c1-7-2-3(8)6-4(7)5/h2H2,1H3,(H2,5,6,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1789 8/PG 3 |
| Boiling Point: | 201.1 oC |
| Density: | 1.47 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | SOLUBLE |
| Solubility: | SOLUBLE in water |
| Appearance: | white powder |
| Specification: | white powder Safety Statements:26-36/37/39-45-24/25-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing |
| HS Code: | 29332990 |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
