| Identification | |
| Name: | 2,3-pentanedione |
| Synonyms: | - |
| CAS: | 600-14-6 |
| EINECS: | 209-984-8 |
| Molecular Formula: | C5H8O2 |
| Molecular Weight: | 100.12 |
| InChI: | InChI=1/C5H8O2/c1-3-5(7)4(2)6/h3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1224 |
| Density: | 0.958 |
| Stability: | Stable. Highly flammable - store cool. Incompatible with strong oxidizing agents, reducing agents, strong bases. |
| Refractive index: | 1.402-1.406 |
| Solubility: | partially soluble |
| Appearance: | clear to yellow liquid |
| Packinggroup: | II |
| HS Code: | 29141990 |
| Color: | very deep green-yellow |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
